(2S)-2-(N-tert-Butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid structure
|
Common Name | (2S)-2-(N-tert-Butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 102507-13-1 | Molecular Weight | 233.262 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 391.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO5 | Melting Point | 116-118℃ | |
| MSDS | N/A | Flash Point | 190.3±26.5 °C | |
| Name | (2S)-3-hydroxy-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.1±37.0 °C at 760 mmHg |
| Melting Point | 116-118℃ |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.262 |
| Flash Point | 190.3±26.5 °C |
| Exact Mass | 233.126328 |
| PSA | 95.86000 |
| LogP | 0.91 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | SZVRVSZFEDIMFM-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2924199090 |
|
~97%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Angewandte Chemie - International Edition, , vol. 50, # 5 p. 1168 - 1170 |
|
~80%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 21, # 14 p. 3996 - 4003 |
|
~80%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Journal of Organic Chemistry, , vol. 68, # 1 p. 177 - 179 |
|
~67%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: WO2004/54974 A2, ; Page 199 ; WO 2004/054974 A2 |
|
~%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Synthesis, , # 5 p. 634 - 636 |
|
~%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Synthesis, , # 5 p. 634 - 636 |
|
~%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Tetrahedron Letters, , vol. 27, # 25 p. 2789 - 2792 |
|
~%
(2S)-2-(N-tert-... CAS#:102507-13-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 16 p. 4329 - 4332 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-boc-3-hydroxy-L-valine |
| boc-l-ser(3,3-dimethyl) |
| N-[(1,1-Dimethylethoxy)Carbonyl]-3-Methyl-L-Threonine |
| (S)-N-Boc-2-Amino-3-hydroxy-3-methylbutanoic acid |
| (2S)-2-(N-tert-Butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid |
| (2S)-2-(N-t-butoxycarbonyl)amino-3-hydroxy-3-methylbutanoic acid |
| (S)-2-Boc-amino-3-hydroxy-3-methylbutyric acid |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-hydroxy-3-methylbutanoic acid |
| 3-Hydroxy-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-valine |
| n-boc-(s)-2-amino-3-hydroxy-3-methylbutanoic acid |
| N-(tert-Butoxycarbonyl)-3-hydroxy-L-valine |
| L-Threonine,N-[(1,1-dimethylethoxy)carbonyl]-3-methyl |
| (S)-2-N-Boc-amino-3-hydroxy-3-methylbutyric acid |
| L-Threonine, N-[(1,1-dimethylethoxy)carbonyl]-3-methyl- |