5-CHLORO-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE structure
|
Common Name | 5-CHLORO-4-METHYL-1H-PYRROLO[2,3-B]PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 10254-86-1 | Molecular Weight | 277.78900 | |
| Density | N/A | Boiling Point | 362ºC at 760 mmHg | |
| Molecular Formula | C16H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | 4-(4-tert-butylphenoxy)aniline,hydrochloride |
|---|
| Boiling Point | 362ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.78900 |
| Flash Point | 167.3ºC |
| Exact Mass | 277.12300 |
| PSA | 35.25000 |
| LogP | 5.74180 |
| Vapour Pressure | 2E-05mmHg at 25°C |
| InChIKey | IBZHNNRTPMXCPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(N)cc2)cc1.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |