4-[[3-(4-carboxyanilino)-3-oxopropanoyl]amino]benzoic acid structure
|
Common Name | 4-[[3-(4-carboxyanilino)-3-oxopropanoyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 10256-16-3 | Molecular Weight | 342.30300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[3-(4-carboxyanilino)-3-oxopropanoyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14N2O6 |
|---|---|
| Molecular Weight | 342.30300 |
| Exact Mass | 342.08500 |
| PSA | 132.80000 |
| LogP | 2.19630 |
| InChIKey | NPCIOPZZQQSOPU-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)Nc1ccc(C(=O)O)cc1)Nc1ccc(C(=O)O)cc1 |
|
~95%
4-[[3-(4-carbox... CAS#:10256-16-3 |
| Literature: Ukrainets, Igor V.; Bezugly, Peter A.; Treskach, Vladimir I.; Taran, Svetlana G.; Gorokhova, Olga V. Tetrahedron, 1994 , vol. 50, # 34 p. 10331 - 10338 |
|
~%
4-[[3-(4-carbox... CAS#:10256-16-3 |
| Literature: Ukrainets, Igor V.; Bezugly, Peter A.; Treskach, Vladimir I.; Taran, Svetlana G.; Gorokhova, Olga V. Tetrahedron, 1994 , vol. 50, # 34 p. 10331 - 10338 |
|
~%
4-[[3-(4-carbox... CAS#:10256-16-3 |
| Literature: Braeuniger,H.; Stens,B. Pharmazie, 1963 , vol. 18, # 9 p. 585 - 600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4,4'-malonyldiamino-di-benzoic acid |
| 4,4'-[(1,3-dioxopropane-1,3-diyl)diimino]dibenzoic acid |
| N,N'-di-4-carboxyanilide of malonic acid |
| N.N'-Malonyl-bis-<p-amino-benzoesaeure> |
| 4-((3-(4-Carboxyanilino)-3-oxopropanoyl)amino)benzoic acid |
| Bio-0355 |
| Malaben |
| Malonanilid-dicarbonsaeure-(4.4') |
| N.N'-Bis-(4-carboxy-phenyl)-malonamid |
| N.N'-Malonyl-bis-(4-amino-benzoesaeure) |
| 4,4'-Malonyldiamino-di-benzoesaeure |