1-Iodo-1H,1H-perfluorooctane structure
|
Common Name | 1-Iodo-1H,1H-perfluorooctane | ||
|---|---|---|---|---|
| CAS Number | 10258-49-8 | Molecular Weight | 509.98200 | |
| Density | 1.95 g/cm3 | Boiling Point | 181.3ºC at 760 mmHg | |
| Molecular Formula | C8H2F15I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.2ºC | |
| Name | 1-Iodo-1H,1H-perfluorooctane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.95 g/cm3 |
|---|---|
| Boiling Point | 181.3ºC at 760 mmHg |
| Molecular Formula | C8H2F15I |
| Molecular Weight | 509.98200 |
| Flash Point | 77.2ºC |
| Exact Mass | 509.89600 |
| LogP | 5.79550 |
| Vapour Pressure | 1.16mmHg at 25°C |
| Index of Refraction | 1.336 |
| InChIKey | CVJNJHVXFLKZGB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CI |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S23-24/25 |
| HS Code | 2903799090 |
|
~74%
1-Iodo-1H,1H-pe... CAS#:10258-49-8 |
| Literature: European Journal of Organic Chemistry, , # 4 p. 874 - 877 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-8-iodooctane |