2-[bis(2-hydroxyethyl)amino]ethanol,2-(4-methylphenyl)sulfonylacetic acid structure
|
Common Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-(4-methylphenyl)sulfonylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 102582-89-8 | Molecular Weight | 363.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-(4-methylphenyl)sulfonylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H25NO7S |
|---|---|
| Molecular Weight | 363.42700 |
| Exact Mass | 363.13500 |
| PSA | 143.75000 |
| LogP | 0.19940 |
| InChIKey | ZVSSXYVNOYLDJR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)O)cc1.OCCN(CCO)CCO |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4-Methylphenylsulfonyl)acetic acid triethanolamine |
| (p-Tolylsulfonyl)acetic acid compd. with 2,2',2''-nitrilotrisethanol (1:1) |
| Acetic acid,(p-tolylsulfonyl)-,compd. with 2,2',2''-nitrilotrisethanol (1:1) |
| Acetic acid,((4-methylphenyl)sulfonyl)-,compd. with 2,2',2''-nitrilotris(ethanol) (1:1) |