6-[(2,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol structure
|
Common Name | 6-[(2,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 102616-66-0 | Molecular Weight | 373.40000 | |
| Density | 1.295g/cm3 | Boiling Point | 540.5ºC at 760mmHg | |
| Molecular Formula | C20H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | 6-[(2,4-dimethoxyphenyl)-morpholin-4-ylmethyl]-1,3-benzodioxol-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 540.5ºC at 760mmHg |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.40000 |
| Flash Point | 280.7ºC |
| Exact Mass | 373.15300 |
| PSA | 69.62000 |
| LogP | 2.49760 |
| Vapour Pressure | 2.69E-12mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | NCPFBIXFCFNTIV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(c2cc3c(cc2O)OCO3)N2CCOCC2)c(OC)c1 |
|
~96%
6-[(2,4-dimetho... CAS#:102616-66-0 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 4 p. 993 - 995 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-((2,4-Dimethoxyphenyl)(4-morpholinyl)methyl)-1,3-benzodioxol-5-ol |
| 1,3-Benzodioxol-5-ol,6-((2,4-dimethoxyphenyl)-4-morpholinylmethyl) |