9,10-Anthracenedione,2-amino-1-nitro- structure
|
Common Name | 9,10-Anthracenedione,2-amino-1-nitro- | ||
|---|---|---|---|---|
| CAS Number | 10262-82-5 | Molecular Weight | 268.22400 | |
| Density | 1.548g/cm3 | Boiling Point | 557.5ºC at 760mmHg | |
| Molecular Formula | C14H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291ºC | |
| Name | 2-amino-1-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 557.5ºC at 760mmHg |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22400 |
| Flash Point | 291ºC |
| Exact Mass | 268.04800 |
| PSA | 105.98000 |
| LogP | 3.05680 |
| Vapour Pressure | 1.83E-12mmHg at 25°C |
| Index of Refraction | 1.734 |
| InChIKey | MTXKQBHZBNCFSC-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1[N+](=O)[O-])C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~%
9,10-Anthracene... CAS#:10262-82-5 |
| Literature: Ullmann; Medenwald Chemische Berichte, 1913 , vol. 46, p. 1807 |
|
~%
9,10-Anthracene... CAS#:10262-82-5 |
| Literature: Ullmann; Medenwald Chemische Berichte, 1913 , vol. 46, p. 1807 |
|
~%
9,10-Anthracene... CAS#:10262-82-5 |
| Literature: Bayer and Co. Patent: DE167410 ; |
|
~%
9,10-Anthracene... CAS#:10262-82-5 |
| Literature: Bayer and Co. Patent: DE167410 ; |
|
~%
9,10-Anthracene... CAS#:10262-82-5 |
| Literature: Ullmann; Medenwald Chemische Berichte, 1913 , vol. 46, p. 1807 |
|
~%
9,10-Anthracene... CAS#:10262-82-5 |
| Literature: Ullmann; Medenwald Chemische Berichte, 1913 , vol. 46, p. 1807 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Amino-1-nitro-anthrachinon |
| 2-amino-1-nitro-anthraquinone |
| 9,2-amino-1-nitro |