9,10-Anthracenedione,2-amino-1-bromo-3-chloro- structure
|
Common Name | 9,10-Anthracenedione,2-amino-1-bromo-3-chloro- | ||
|---|---|---|---|---|
| CAS Number | 117-01-1 | Molecular Weight | 336.56800 | |
| Density | 1.776g/cm3 | Boiling Point | 545.7ºC at 760mmHg | |
| Molecular Formula | C14H7BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.8ºC | |
| Name | 2-amino-1-bromo-3-chloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.776g/cm3 |
|---|---|
| Boiling Point | 545.7ºC at 760mmHg |
| Molecular Formula | C14H7BrClNO2 |
| Molecular Weight | 336.56800 |
| Flash Point | 283.8ºC |
| Exact Mass | 334.93500 |
| PSA | 60.16000 |
| LogP | 4.04130 |
| Vapour Pressure | 5.78E-12mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | ZFWJIKSKKWACEX-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc2c(c1Br)C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Anthraquinone,2-amino-1-bromo-3-chloro |
| 2-Amino-1-brom-3-chlor-anthrachinon |
| 2-amino-1-bromo-3-chloro-9,10-anthracenedione |
| 2-Amino-1-bromo-3-chloro-anthraquinone |
| 1-Brom-2-amino-3-chlor-anthrachinon-(9.10) |