(2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride structure
|
Common Name | (2E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 10263-19-1 | Molecular Weight | 256.68200 | |
| Density | 1.216g/cm3 | Boiling Point | 375.8ºC at 760 mmHg | |
| Molecular Formula | C12H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.8ºC | |
| Name | (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760 mmHg |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.68200 |
| Flash Point | 153.8ºC |
| Exact Mass | 256.05000 |
| PSA | 44.76000 |
| LogP | 2.49100 |
| Vapour Pressure | 7.6E-06mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | NFFPFTGFVSWSTH-SNAWJCMRSA-N |
| SMILES | COc1cc(C=CC(=O)Cl)cc(OC)c1OC |
|
~97%
(2E)-3-(3,4,5-t... CAS#:10263-19-1 |
| Literature: Organic and Biomolecular Chemistry, , vol. 3, # 11 p. 2150 - 2154 |
|
~%
(2E)-3-(3,4,5-t... CAS#:10263-19-1 |
| Literature: European Journal of Medicinal Chemistry, , vol. 37, # 12 p. 961 - 972 |
| (E)-3-(3,4,5-trimethoxyphenyl)acryloyl chloride |
| 3',4',5'-Trimethoxycinnamoyl chloride |
| (E)-3,4,5-trimethoxy-cinnamic acid chloride |
| (E)-3,4,5-trimethoxycinnamoyl chloride |
| trans-3-(3,4,5-trimethoxyphenyl)-acryloyl chloride |
| 3-(3,4,5-trimethoxy-phenyl)-acryloyl chloride |
| EINECS 233-601-3 |
| F2190-0092 |
| trans-3,4,5-trimethoxycinnamic acid chloride |