1H-Indole-3-butanoic acid monosodium salt structure
|
Common Name | 1H-Indole-3-butanoic acid monosodium salt | ||
|---|---|---|---|---|
| CAS Number | 10265-70-0 | Molecular Weight | 225.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12NNaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1H-Indole-3-butanoic acid monosodium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12NNaO2 |
|---|---|
| Molecular Weight | 225.21900 |
| Exact Mass | 225.07700 |
| PSA | 55.92000 |
| LogP | 1.24050 |
| InChIKey | VBDSTGDTZFQGNC-UHFFFAOYSA-M |
| SMILES | O=C([O-])CCCc1c[nH]c2ccccc12.[Na+] |
| HS Code | 2933990090 |
|---|
|
~%
1H-Indole-3-but... CAS#:10265-70-0 |
| Literature: Chilwal, Asha; Malhotra, Priti; Narula Phosphorus, Sulfur and Silicon and the Related Elements, 2014 , vol. 189, # 3 p. 410 - 421 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-indolebutyric acid sodium salt |
| indole-3-butyric acid sodium salt |
| sodium indole-3-butyrate |
| SODIUM 3-INDOLEBUTYRATE |