5-tert-butyl-2-chloro-1,3-benzoxazole structure
|
Common Name | 5-tert-butyl-2-chloro-1,3-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 1027076-19-2 | Molecular Weight | 209.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-tert-butyl-2-chloro-1,3-benzoxazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12ClNO |
|---|---|
| Molecular Weight | 209.67200 |
| Exact Mass | 209.06100 |
| PSA | 26.03000 |
| LogP | 3.77870 |
| InChIKey | DSJHZFICMUDISP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2oc(Cl)nc2c1 |
| HS Code | 2934999090 |
|---|
|
~%
5-tert-butyl-2-... CAS#:1027076-19-2 |
| Literature: Yoshida, Satoshi; Watanabe, Takashi; Sato, Yasuo Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 10 p. 3515 - 3523 |
|
~%
5-tert-butyl-2-... CAS#:1027076-19-2 |
| Literature: Haviv; Ratajczyk; DeNet; Kerdesky; Walters; Schmidt; Holms; Young; Carter Journal of Medicinal Chemistry, 1988 , vol. 31, # 9 p. 1719 - 1728 |
|
~%
5-tert-butyl-2-... CAS#:1027076-19-2 |
| Literature: Yoshida, Satoshi; Watanabe, Takashi; Sato, Yasuo Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 10 p. 3515 - 3523 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-5-tert-butylbenzoxazole |
| 5-tert-Butyl-2-chloro-benzooxazole |
| 5-(tert-butyl)-2-chlorobenzoxazole |