Benzenemethanesulfonicacid, phenyl ester structure
|
Common Name | Benzenemethanesulfonicacid, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 10271-81-5 | Molecular Weight | 248.29800 | |
| Density | 1.272g/cm3 | Boiling Point | 408.6ºC at 760 mmHg | |
| Molecular Formula | C13H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | phenyl phenylmethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 408.6ºC at 760 mmHg |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.29800 |
| Flash Point | 200.9ºC |
| Exact Mass | 248.05100 |
| PSA | 51.75000 |
| LogP | 3.67620 |
| Vapour Pressure | 1.64E-06mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | DTVYDCGCCHOJMQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)Oc1ccccc1 |
| HS Code | 2906299090 |
|---|
|
~%
Benzenemethanes... CAS#:10271-81-5 |
| Literature: Shirota,Y. et al. Tetrahedron, 1967 , vol. 23, p. 639 - 648 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| phenyl-methanesulfonic acid phenyl ester |
| BENZYLSULFONYLOXYBENZENE |
| HMS2863B10 |
| benzyl ester of sulphonic acid,phenylester |
| Phenylmethansulfonsaeure-phenylester |