4-[[(1R)-3-(4-Morpholinyl)-3-oxo-1-[(phenylthio)methyl]propyl]amino]-3-trifluoromethylsulfonyl-benzenesulfonamide structure
|
Common Name | 4-[[(1R)-3-(4-Morpholinyl)-3-oxo-1-[(phenylthio)methyl]propyl]amino]-3-trifluoromethylsulfonyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1027345-11-4 | Molecular Weight | 567.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24F3N3O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[(2R)-4-morpholin-4-yl-4-oxo-1-phenylsulfanylbutan-2-yl]amino]-3-(trifluoromethylsulfonyl)benzenesulfonamide |
|---|
| Molecular Formula | C21H24F3N3O6S3 |
|---|---|
| Molecular Weight | 567.62200 |
| Exact Mass | 567.07800 |
| PSA | 177.93000 |
| LogP | 5.32200 |
| InChIKey | FVVGOJKXBWLQFS-OAHLLOKOSA-N |
| SMILES | NS(=O)(=O)c1ccc(NC(CSc2ccccc2)CC(=O)N2CCOCC2)c(S(=O)(=O)C(F)(F)F)c1 |
|
~86%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: ASTRAZENECA AB Patent: US2012/35134 A1, 2012 ; Location in patent: Page/Page column 55; 56 ; |
|
~77%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: GENENTECH, INC.; WALTER AND ELIZA HALL INSTITUTE OF MEDICAL RESEARCH Patent: WO2008/61208 A2, 2008 ; Location in patent: Page/Page column 38 ; WO 2008/061208 A2 |
|
~%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: US2012/35134 A1, ; |
|
~%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: US2012/35134 A1, ; |
|
~%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: US2012/35134 A1, ; |
|
~%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: US2012/35134 A1, ; |
|
~%
4-[[(1R)-3-(4-M... CAS#:1027345-11-4 |
| Literature: US2012/35134 A1, ; |