Benzoquinoneacetic acid structure
|
Common Name | Benzoquinoneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 10275-07-7 | Molecular Weight | 166.13100 | |
| Density | 1.429g/cm3 | Boiling Point | 344ºC at 760mmHg | |
| Molecular Formula | C8H6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176ºC | |
| Name | 2-(3,6-dioxocyclohexa-1,4-dien-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 344ºC at 760mmHg |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13100 |
| Flash Point | 176ºC |
| Exact Mass | 166.02700 |
| PSA | 71.44000 |
| LogP | 0.09550 |
| Vapour Pressure | 1.22E-05mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | RAPRJRLALQKSHB-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)C(CC(=O)O)=C1 |
| HS Code | 2918300090 |
|---|
|
~%
Benzoquinoneace... CAS#:10275-07-7 |
| Literature: Moerner Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1912 , vol. 78, p. 306,325 |
|
~%
Benzoquinoneace... CAS#:10275-07-7 |
| Literature: Moerner Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1912 , vol. 78, p. 306,325 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (3,6-Dioxo-cyclohexa-1,4-dienyl)-essigsaeure |
| Cyclohexadien-(1.4)-dion-(3.6)-essigsaeure-(1) |
| 1,4-benzoquinonylacetic acid |
| Chinonessigsaeure |
| Benzoquinoneaceticacid |
| 2-carboxymethyl-1,4-benzoquinone |
| 1,4-Cyclohexadiene-1-aceticacid,3,6-dioxo |
| Benzochinon-(1.4)-essigsaeure-(2) |
| Benzoquinoneacetate |
| (3,6-dioxo-cyclohexa-1,4-dienyl)-acetic acid |
| BQA |