2'-Deoxycytidine-5'-triphosphoric acid disodium salt structure
|
Common Name | 2'-Deoxycytidine-5'-triphosphoric acid disodium salt | ||
|---|---|---|---|---|
| CAS Number | 102783-51-7 | Molecular Weight | 511.121 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N3Na2O13P3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2’-Deoxycytidine 5’-Triphosphate Disodium Salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14N3Na2O13P3 |
|---|---|
| Molecular Weight | 511.121 |
| Exact Mass | 510.953491 |
| PSA | 285.28000 |
| LogP | 0.27480 |
| InChIKey | ABWVCNMFYVEBIB-CDNBRZBRSA-L |
| SMILES | Nc1ccn(C2CC(O)C(COP(=O)([O-])OP(=O)(O)OP(=O)([O-])O)O2)c(=O)n1.[Na+].[Na+] |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn,Xi |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S26-S36-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Quantitation of cellular deoxynucleoside triphosphates.
Nucleic Acids Res. 38 , e85, (2010) Eukaryotic cells contain a delicate balance of minute amounts of the four deoxyribonucleoside triphosphates (dNTPs), sufficient only for a few minutes of DNA replication. Both a deficiency and a surpl... |
|
|
Structural basis for proficient incorporation of dTTP opposite O6-methylguanine by human DNA polymerase iota.
J. Biol. Chem. 285 , 40666-40672, (2010) O(6)-methylguanine (O(6)-methylG) is highly mutagenic and is commonly found in DNA exposed to methylating agents, even physiological ones (e.g. S-adenosylmethionine). The efficiency of a truncated, ca... |
|
|
Structure of the human Rev1-DNA-dNTP ternary complex.
J. Mol. Biol. 390 , 699-709, (2009) Y-family DNA polymerases have proven to be remarkably diverse in their functions and in strategies for replicating through DNA lesions. The structure of yeast Rev1 ternary complex has revealed the mos... |
| 2'-Deoxycytidine-5'-triphosphoric acid disodium salt |
| Cytidine, 2'-deoxy-, 5'-(tetrahydrogen triphosphate), sodium salt (1:2) |
| Disodium 2'-deoxy-5'-O-[({hydroxy[(hydroxyphosphinato)oxy]phosphoryl}oxy)phosphinato]cytidine |
| MFCD00084683 |
| 2'-Deoxycytidine-5'-triphosphate disodium salt |
| Disodium 2'-deoxy-5'-O-[hydroxy({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphoryl]cytidine |
| 2'-Deoxycytidine 5'-triphosphate disodium salt |