3,5-Difluoro-4-hydroxybenzeneboronic acid pinacol ester structure
|
Common Name | 3,5-Difluoro-4-hydroxybenzeneboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 1029439-83-5 | Molecular Weight | 256.05400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BF2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15BF2O3 |
|---|---|
| Molecular Weight | 256.05400 |
| Exact Mass | 256.10800 |
| PSA | 38.69000 |
| LogP | 1.96960 |
| InChIKey | KTQYJNVSVKKLGQ-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cc(F)c(O)c(F)c2)OC1(C)C |
|
~%
3,5-Difluoro-4-... CAS#:1029439-83-5 |
| Literature: Mita, Yusuke; Noguchi-Yachide, Tomomi; Ishikawa, Minoru; Hashimoto, Yuichi Bioorganic and Medicinal Chemistry, 2013 , vol. 21, # 3 p. 608 - 617 |
|
~%
3,5-Difluoro-4-... CAS#:1029439-83-5 |
| Literature: Mita, Yusuke; Noguchi-Yachide, Tomomi; Ishikawa, Minoru; Hashimoto, Yuichi Bioorganic and Medicinal Chemistry, 2013 , vol. 21, # 3 p. 608 - 617 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-difluoro-4-hydroxyphenylboronic acid pinacol ester |
| 3,5-difluoro-4-hydroxybenzeneboronic acid pinacol ester |
| 2,5-dichlorothiophene-3-sulfinic acid sodium salt |