2,3-bis(sulfanyl)propyl 4-chlorobenzoate structure
|
Common Name | 2,3-bis(sulfanyl)propyl 4-chlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 103038-53-5 | Molecular Weight | 262.77600 | |
| Density | 1.308g/cm3 | Boiling Point | 389.7ºC at 760mmHg | |
| Molecular Formula | C10H11ClO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.5ºC | |
| Name | 2,3-bis(sulfanyl)propyl 4-chlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 389.7ºC at 760mmHg |
| Molecular Formula | C10H11ClO2S2 |
| Molecular Weight | 262.77600 |
| Flash Point | 189.5ºC |
| Exact Mass | 261.98900 |
| PSA | 103.90000 |
| LogP | 2.72500 |
| Vapour Pressure | 2.8E-06mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | UJCJVOYPSDNLRN-UHFFFAOYSA-N |
| SMILES | O=C(OCC(S)CS)c1ccc(Cl)cc1 |
|
~%
2,3-bis(sulfany... CAS#:103038-53-5 |
| Literature: Journal of the Chemical Society, , p. 2674 - 2680 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| BRL 637 |
| 4-Chlor-benzoesaeure-<2.3-dimercapto-propylester> |
| 1-Propanol,2,3-dimercapto-,1-p-chlorobenzoate |
| 2,3-Dimercapto-1-propanol 1-p-chlorobenzoate |
| 2,3-Disulfanylpropyl 4-chlorobenzoate |
| 2,3-Dimercaptopropyl p-chlorobenzoate |
| BENZOIC ACID,p-CHLORO-,2,3-DIMERCAPTOPROPYL ESTER |
| p-Chlor-benzoesaeure-(2.3-dimercaptopropyl)-ester |