N-[5-(6-aminopurin-9-yl)pentyl]-6-chloro-2-methoxyacridin-9-amine structure
|
Common Name | N-[5-(6-aminopurin-9-yl)pentyl]-6-chloro-2-methoxyacridin-9-amine | ||
|---|---|---|---|---|
| CAS Number | 103061-92-3 | Molecular Weight | 461.94700 | |
| Density | 1.43g/cm3 | Boiling Point | 745.6ºC at 760 mmHg | |
| Molecular Formula | C24H24ClN7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 404.7ºC | |
| Name | N-[5-(6-aminopurin-9-yl)pentyl]-6-chloro-2-methoxyacridin-9-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 745.6ºC at 760 mmHg |
| Molecular Formula | C24H24ClN7O |
| Molecular Weight | 461.94700 |
| Flash Point | 404.7ºC |
| Exact Mass | 461.17300 |
| PSA | 107.00000 |
| LogP | 5.05740 |
| Vapour Pressure | 4.2E-22mmHg at 25°C |
| Index of Refraction | 1.721 |
| InChIKey | HOEGYNKQQVMFPU-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCCCn3cnc4c(N)ncnc43)c2c1 |
|
~%
N-[5-(6-aminopu... CAS#:103061-92-3 |
| Literature: Constant; Carden; Lhomme Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 4 p. 1035 - 1040 |
|
~%
N-[5-(6-aminopu... CAS#:103061-92-3 |
| Literature: Constant; Carden; Lhomme Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 4 p. 1035 - 1040 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| n-[5-(6-amino-9h-purin-9-yl)pentyl]-6-chloro-2-methoxyacridin-9-amine |
| 6-chloro-2-methoxy-9-<(5-(aden-9-yl)pentyl)amino>acridine |