N-(5-Bromopentyl)phthalimide structure
|
Common Name | N-(5-Bromopentyl)phthalimide | ||
|---|---|---|---|---|
| CAS Number | 954-81-4 | Molecular Weight | 296.160 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 393.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H14BrNO2 | Melting Point | 58 °C | |
| MSDS | Chinese USA | Flash Point | 191.5±23.2 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | N-(5-Bromopentyl)phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 393.1±25.0 °C at 760 mmHg |
| Melting Point | 58 °C |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.160 |
| Flash Point | 191.5±23.2 °C |
| Exact Mass | 295.020782 |
| PSA | 37.38000 |
| LogP | 3.54 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | QKVHAKICMNABGB-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCBr |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H317-H319-H335-H400 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2925190090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H-Isoindole-1,3(2H)-dione, 2-(5-bromopentyl)- |
| 2-(5-bromopentyl)isoindole-1,3-dione |
| 2-(5-Bromopentyl)-1H-isoindole-1,3(2H)-dione |
| MFCD00060522 |