Ethanone,1-(4-phenyl-4-piperidinyl)-,hydrochloride (1:1) structure
|
Common Name | Ethanone,1-(4-phenyl-4-piperidinyl)-,hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 10315-03-4 | Molecular Weight | 239.74100 | |
| Density | N/A | Boiling Point | 325.2ºC at 760 mmHg | |
| Molecular Formula | C13H18ClNO | Melting Point | 232-234ºC(lit.) | |
| MSDS | USA | Flash Point | 125.7ºC | |
| Name | 4-Acetyl-4-phenylpiperidine Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 325.2ºC at 760 mmHg |
|---|---|
| Melting Point | 232-234ºC(lit.) |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.74100 |
| Flash Point | 125.7ºC |
| Exact Mass | 239.10800 |
| PSA | 29.10000 |
| LogP | 3.02760 |
| Vapour Pressure | 0.000234mmHg at 25°C |
| InChIKey | JYDHZOIDIWUHDB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(c2ccccc2)CCNCC1.Cl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~%
Ethanone,1-(4-p... CAS#:10315-03-4 |
| Literature: Journal of Organic Chemistry, , vol. 22, p. 1484,1488 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Laser flash photolysis of new water-soluble peroxyl radical precursor. El-Agamey A.
J. Photochem. Photobiol. A: Chem. 203(1) , 13-17, (2009)
|
| EINECS 233-694-0 |
| 1-(4-phenylpiperidin-4-yl)ethanone,hydrochloride |
| MFCD00039037 |
| 4-Acetyl-4-phenylpiperidine hydrochloride |