(5S)-5-[(Dimethylamino)methyl]-1-{[hydroxy(methoxy)phosphoryl]oxy }-4,5-dihydro-1H-imidazol-2-amine structure
|
Common Name | (5S)-5-[(Dimethylamino)methyl]-1-{[hydroxy(methoxy)phosphoryl]oxy }-4,5-dihydro-1H-imidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 103170-78-1 | Molecular Weight | 252.20800 | |
| Density | 1.52g/cm3 | Boiling Point | 361.7ºC at 760mmHg | |
| Molecular Formula | C7H17N4O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | (5S)-5-[(Dimethylamino)methyl]-1-{[hydroxy(methoxy)phosphoryl]oxy }-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 361.7ºC at 760mmHg |
| Molecular Formula | C7H17N4O4P |
| Molecular Weight | 252.20800 |
| Flash Point | 172.6ºC |
| Exact Mass | 252.09900 |
| PSA | 107.93000 |
| Vapour Pressure | 3.24E-06mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | FYXHGVMFJYHPFX-ZCFIWIBFSA-N |
| SMILES | COP(=O)(O)ON1C(N)=NCC1CN(C)C |
|
~%
(5S)-5-[(Dimeth... CAS#:103170-78-1 |
| Literature: Hemscheidt, Thomas; Burgoyne, David L.; Moore, Richard E. Journal of the Chemical Society, Chemical Communications, 1995 , # 2 p. 205 - 206 |
| Anatoxin-a(s) |
| Anaferine hydrochloride |