Tubulysin IM-2 structure
|
Common Name | Tubulysin IM-2 | ||
|---|---|---|---|---|
| CAS Number | 1032072-50-6 | Molecular Weight | 538.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H42N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tubulysin IM-2Tubulysin IM-2 is an ADC Cytotoxin and tubulin binder used as anti-microtubule toxins. |
| Name | Tubulysin IM-2 |
|---|
| Description | Tubulysin IM-2 is an ADC Cytotoxin and tubulin binder used as anti-microtubule toxins. |
|---|---|
| Related Catalog | |
| Target |
Traditional Cytotoxic Agents |
| References |
| Molecular Formula | C26H42N4O6S |
|---|---|
| Molecular Weight | 538.70 |
| InChIKey | FTNZYSKQMXPJIO-VBVPVEISSA-N |
| SMILES | CCC(C)C(NC(=O)C1CCCCN1C)C(=O)N(C)C(CC(OC(C)=O)c1nc(C(=O)O)cs1)C(C)C |