2,6-ditert-butyl-4-(2,2-dimethylpropyl)phenol structure
|
Common Name | 2,6-ditert-butyl-4-(2,2-dimethylpropyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 10324-61-5 | Molecular Weight | 276.45700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-(2,2-dimethylpropyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H32O |
|---|---|
| Molecular Weight | 276.45700 |
| Exact Mass | 276.24500 |
| PSA | 20.23000 |
| LogP | 5.57580 |
| InChIKey | YSZJTPDJLDYKAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
|
~35%
2,6-ditert-buty... CAS#:10324-61-5
Detail
|
| Literature: Tanko, James M.; Brammer, Larry E. Journal of the Chemical Society, Chemical Communications, 1994 , # 10 p. 1165 - 1166 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-Di-tert-butyl-4-neopentyl-phenol |
| 4-Neopentyl-2,6-di-tert-butylphenol |