[[5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate,sodium structure
|
Common Name | [[5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate,sodium | ||
|---|---|---|---|---|
| CAS Number | 103301-72-0 | Molecular Weight | 628.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25N5NaO16P2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [[5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate,sodium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25N5NaO16P2 |
|---|---|
| Molecular Weight | 628.33100 |
| Exact Mass | 628.06700 |
| PSA | 352.33000 |
| InChIKey | XHHMWQPKNONDQU-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2C2OC(COP(=O)(O)OP(=O)(O)OC3OC(CO)C(O)C(O)C3O)C(O)C2O)c(=O)[nH]1.[Na] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
Low glucose depletes glycan precursors, reduces site occupancy and galactosylation of a monoclonal antibody in CHO cell culture.
Biotechnol. J. 10 , 1051-66, (2015) Controlled feeding of glucose has been employed previously to enhance the productivity of recombinant glycoproteins but there is a concern that low concentrations of glucose could limit the synthesis ... |
|
|
Structural and Enzymatic Characterization of a Nucleoside Diphosphate Sugar Hydrolase from Bdellovibrio bacteriovorus.
PLoS ONE 10 , e0141716, (2015) Given the broad range of substrates hydrolyzed by Nudix (nucleoside diphosphate linked to X) enzymes, identification of sequence and structural elements that correctly predict a Nudix substrate or cha... |
|
|
Aging without Apolipoprotein D: Molecular and cellular modifications in the hippocampus and cortex.
Exp. Gerontol. 67 , 19-47, (2015) A detailed knowledge of the mechanisms underlying brain aging is fundamental to understand its functional decline and the baseline upon which brain pathologies superimpose. Endogenous protective mecha... |
| Guanosine 5 inverted exclamation marka-diphosphoglucose sodium salt |
| Guanosine 5'-diphospho-D-mannose sodium salt from Saccharomyces cerevisiae |
| GDP-Glc |
| Guanosine 5 inverted exclamation marka-diphospho-D-mannose sodium salt from Saccharomyces cerevisiae |
| Guanosine 5'-diphosphoglucose sodium salt |
| GDP-glucose |
| GDP-Man |