D-Erythrose 4-phosphate sodium structure
|
Common Name | D-Erythrose 4-phosphate sodium | ||
|---|---|---|---|---|
| CAS Number | 103302-15-4 | Molecular Weight | 222.06600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H8NaO7P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of D-Erythrose 4-phosphate sodiumD-Erythrose 4-phosphate sodium is a phosphate sodium of the simple sugar Erythrose. Erythritol is actually converted into D-Erythrose 4-phosphate that involves three isomerases[1]. |
| Name | sodium,[(2R,3R)-2,3-dihydroxy-4-oxobutyl] hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Description | D-Erythrose 4-phosphate sodium is a phosphate sodium of the simple sugar Erythrose. Erythritol is actually converted into D-Erythrose 4-phosphate that involves three isomerases[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Erythritol is a preferential substrate for Brucella. Erythritol is actually converted into D-erythrose-4-phosphate through a set of reactions that involves three isomerases and that allows hexose-monophosphate synthesis and growth by feeding the pentose phosphate shunt[1]. |
| References |
| Molecular Formula | C4H8NaO7P |
|---|---|
| Molecular Weight | 222.06600 |
| Exact Mass | 221.99100 |
| PSA | 136.93000 |
| InChIKey | DNVYGENAKKIOOX-RFKZQXLXSA-N |
| SMILES | O=CC(O)C(O)COP(=O)(O)O.[Na] |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 2919900090 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Gas Chromatography-Quadrupole Time-of-Flight Mass Spectrometry-Based Determination of Isotopologue and Tandem Mass Isotopomer Fractions of Primary Metabolites for (13)C-Metabolic Flux Analysis.
Anal. Chem. 87 , 11792-802, (2015) For the first time an analytical work flow based on accurate mass gas chromatography-quadrupole time-of-flight mass spectrometry (GC-QTOFMS) with chemical ionization for analysis providing a comprehen... |
|
|
Poisoning pyridoxal 5-phosphate-dependent enzymes: a new strategy to target the malaria parasite Plasmodium falciparum.
PLoS ONE 4(2) , e4406, (2009) The human malaria parasite Plasmodium falciparum is able to synthesize de novo pyridoxal 5-phosphate (PLP), a crucial cofactor, during erythrocytic schizogony. However, the parasite possesses addition... |
|
|
Exploring inhibition of Pdx1, a component of the PLP synthase complex of the human malaria parasite Plasmodium falciparum.
Biochem. J. 449(1) , 175-87, (2013) Malaria tropica is a devastating infectious disease caused by Plasmodium falciparum. This parasite synthesizes vitamin B6 de novo via the PLP (pyridoxal 5'-phosphate) synthase enzymatic complex consis... |
| sodium D-erythrose 4-phosphate |
| E4P sodium salt |
| D-Erythrose 4-phosphate sodium salt |
| 4-Phospho-D-erythrose sodium salt |