Pentaerythritol oleate structure
|
Common Name | Pentaerythritol oleate | ||
|---|---|---|---|---|
| CAS Number | 10332-32-8 | Molecular Weight | 400.592 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 523.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H44O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 165.5±23.6 °C | |
| Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 523.6±50.0 °C at 760 mmHg |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.592 |
| Flash Point | 165.5±23.6 °C |
| Exact Mass | 400.318878 |
| PSA | 86.99000 |
| LogP | 7.09 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | QQVGEJLUEOSDBB-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)(CO)CO |
| HS Code | 2916150000 |
|---|
| HS Code | 2916150000 |
|---|---|
| Summary | 2916150000 oleic, linoleic or linolenic acids, their salts and esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9-Octadecenoic acid, 3-hydroxy-2,2-bis(hydroxymethyl)propyl ester, (9Z)- |
| 9-Octadecenoic acid (Z)-,3-hydroxy-2,2-bis(hydroxymethyl)propyl ester |
| Pentaerythritol oleate |
| 3-Hydroxy-2,2-bis(hydroxymethyl)propyl (9Z)-9-octadecenoate |
| 9-Octadecenoic acid (9Z)-,3-hydroxy-2,2-bis(hydroxymethyl)propyl ester |
| 3-hydroxy-2,2-bis(hydroxymethyl)propyl oleate |
| Pentaerythritol monooleate |
| Pentaerythritylmonooleat |
| EINECS 233-723-7 |
| 3-Hydroxy-2,2-bis(hydroxymethyl)propyl (9Z)-octadec-9-enoate |