Pentaerythritol triacrylate structure
|
Common Name | Pentaerythritol triacrylate | ||
|---|---|---|---|---|
| CAS Number | 3524-68-3 | Molecular Weight | 298.289 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 427.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 153.5±22.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [2-(hydroxymethyl)-3-prop-2-enoyloxy-2-(prop-2-enoyloxymethyl)propyl] prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 427.9±45.0 °C at 760 mmHg |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.289 |
| Flash Point | 153.5±22.2 °C |
| Exact Mass | 298.105255 |
| PSA | 99.13000 |
| LogP | 0.56 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | HVVWZTWDBSEWIH-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(CO)(COC(=O)C=C)COC(=O)C=C |
| Storage condition | 2-8°C |
| Stability | Stable at room temperature, but potentially explosive at elevated temperatures. Combustible, but may explode if involved in a fire. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H317-H319 |
| Precautionary Statements | P280-P301 + P312 + P330-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/38;R43 |
| Safety Phrases | S39 |
| RIDADR | UN3265 |
| WGK Germany | 1 |
| RTECS | UD3370000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2916190090 |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
In vitro and in vivo characterization of pentaerythritol triacrylate-co-trimethylolpropane nanocomposite scaffolds as potential bone augments and grafts.
Tissue Eng. Part A 21(1-2) , 320-31, (2015) A thiol-acrylate-based copolymer synthesized via an amine-catalyzed Michael addition was studied in vitro and in vivo to assess its potential as an in situ polymerizing graft or augment in bone defect... |
|
|
Novel highly hydrophilic methacrylate-based monolithic column with mixed-mode of hydrophilic and strong cation-exchange interactions for pressurized capillary electrochromatography.
J. Chromatogr. A. 1218(29) , 4671-7, (2011) A novel highly hydrophilic polymethacrylate-based monolithic stationary phase based on the copolymerization of 2-acrylamido-2-methyl-1-propanesulfonic acid (AMPS) and pentaerythritol triacrylate (PETA... |
|
|
Application and properties of butyl acrylate/pentaerythrite triacrylate copolymers and cellulose-based Granocel as carriers for trypsin immobilization.
Colloids Surf. B Biointerfaces 61(1) , 66-74, (2008) The main point was the search for a proper carrier and the kind of carrier activation for trypsin (EC 3.4.21.4) immobilization. The acrylic and cellulose-based carriers were specially prepared in that... |
| Pentaerythritol triacrylate |
| Aronix M 305 |
| 3-(acryloyloxy)-2-[(acryloyloxy)methyl]-2-(hydroxymethyl)propyl prop-2-enoate |
| PETA |
| Setalux UV 2242 |
| 2-((Acryloyloxy)methyl)-2-(hydroxymethyl)propane-1,3-diyl diacrylate |
| 3-(Acryloyloxy)-2-[(acryloyloxy)methyl]-2-(hydroxymethyl)propyl acrylate |
| P 300 (acrylate) |
| Sartomer SR 444 |
| 2-propenoic acid, 3-hydroxy-2,2-bis[[(1-oxo-2-propen-1-yl)oxy]methyl]propyl ester |
| Light Acrylate PE 3A |
| Kayarad PET 30 |
| MFCD00009607 |
| pentaerythrityl triacrylate |
| EINECS 222-540-8 |
| 3-(acryloyloxy)-2-[(acryloyloxy)methyl]-2-(hydroxymethyl)propyl prop-2-enoate (non-preferred name) |
| tetramethylolmethane triacrylate |
| Gafgard 233 |