boc-beta-cyclohexyl-l-alaninol structure
|
Common Name | boc-beta-cyclohexyl-l-alaninol | ||
|---|---|---|---|---|
| CAS Number | 103322-56-1 | Molecular Weight | 257.369 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 385.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H27NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 186.9±23.2 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxypropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.4±25.0 °C at 760 mmHg |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.369 |
| Flash Point | 186.9±23.2 °C |
| Exact Mass | 257.199097 |
| PSA | 58.56000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | BOJQBBXPSVGTQT-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)CC1CCCCC1 |
| Storage condition | -15°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
D.J. Krysan et al.
Org. Prep. Proced. Int. 25 , 437, (1993)
|
|
|
M.R. Leanna et al.
Tetrahedron Lett. 33 , 5029, (1992)
|
| Boc-b-cyclohexyl-l-alaninol |
| 2-Methyl-2-propanyl [(2S)-1-cyclohexyl-3-hydroxy-2-propanyl]carbamate |
| tert-Butyl [(2S)-1-cyclohexyl-3-hydroxypropan-2-yl]carbamate |
| Boc-L-Cha-ol |
| MFCD00076899 |
| Carbamic acid, N-[(1S)-2-cyclohexyl-1-(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester |
| Boc-L-cyclohexylalaninol |
| L-Boc-cyclohexylalaninol |
| Boc-cyclohexylalaninol |