ethyl methyl 2-(imidazol-1-ylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-di hydropyridine-3,5-dicarboxylate structure
|
Common Name | ethyl methyl 2-(imidazol-1-ylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-di hydropyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 103417-69-2 | Molecular Weight | 426.42300 | |
| Density | 1.35g/cm3 | Boiling Point | 613.3ºC at 760mmHg | |
| Molecular Formula | C21H22N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.7ºC | |
| Name | 3-O-ethyl 5-O-methyl 2-(imidazol-1-ylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 613.3ºC at 760mmHg |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.42300 |
| Flash Point | 324.7ºC |
| Exact Mass | 426.15400 |
| PSA | 128.27000 |
| LogP | 3.29450 |
| Vapour Pressure | 5.58E-15mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | BFLKGKGRZKABHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(Cn2ccnc2)NC(C)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
|
~%
ethyl methyl 2-... CAS#:103417-69-2 |
| Literature: Archibald; Bradley; Opalko; Ward; White; Ennis; Shepperson Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 646 - 652 |
|
~%
ethyl methyl 2-... CAS#:103417-69-2 |
| Literature: Archibald; Bradley; Opalko; Ward; White; Ennis; Shepperson Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 646 - 652 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |