2-(2,4,6-Trimethylphenyl)-5-methylimidazo[1,5-a]pyridinim chloride structure
|
Common Name | 2-(2,4,6-Trimethylphenyl)-5-methylimidazo[1,5-a]pyridinim chloride | ||
|---|---|---|---|---|
| CAS Number | 1034449-18-7 | Molecular Weight | 286.79900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19ClN2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-methyl-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-4-ium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19ClN2 |
|---|---|
| Molecular Weight | 286.79900 |
| Exact Mass | 286.12400 |
| PSA | 8.29000 |
| LogP | 0.45360 |
| InChIKey | DJFXURXZOPNPGY-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)c(-[n+]2cc3cccc(C)n3c2)c(C)c1.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
Imidazo[1,5-a]pyridine: a versatile architecture for stable N-heterocyclic carbenes.
J. Am. Chem. Soc. 127 , 3290, (2005) The imidazo[1,5-a]pyridine skeleton provides a versatile platform for the generation of new types of stable N-heterocyclic carbenes. Rh(I) mono- (6) and biscarbenes (7) from imidazo[1,5-a]pyridin-3-yl... |
| MFCD09750457 |