1-nitro-4-[(4-nitrophenoxy)-propylphosphoryl]oxybenzene structure
|
Common Name | 1-nitro-4-[(4-nitrophenoxy)-propylphosphoryl]oxybenzene | ||
|---|---|---|---|---|
| CAS Number | 103499-65-6 | Molecular Weight | 366.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N2O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-4-[(4-nitrophenoxy)-propylphosphoryl]oxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15N2O7P |
|---|---|
| Molecular Weight | 366.26300 |
| Exact Mass | 366.06200 |
| PSA | 136.98000 |
| LogP | 5.61030 |
| InChIKey | ZHZOCOISYIDAOU-UHFFFAOYSA-N |
| SMILES | CCCP(=O)(Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
1-nitro-4-[(4-n... CAS#:103499-65-6 |
| Literature: Kovach, Ildiko M.; Larson, Mark; Schowen, Richard L. Journal of the American Chemical Society, 1986 , vol. 108, # 18 p. 5490 - 5495 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bis-4-nitrophenyl propylphosphonate |