9-Dehydroandrostenedione structure
|
Common Name | 9-Dehydroandrostenedione | ||
|---|---|---|---|---|
| CAS Number | 1035-69-4 | Molecular Weight | 284.39300 | |
| Density | 1.14g/cm3 | Boiling Point | 448.5ºC at 760mmHg | |
| Molecular Formula | C19H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | (8S,10S,13S,14S)-10,13-dimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760mmHg |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.39300 |
| Flash Point | 167.2ºC |
| Exact Mass | 284.17800 |
| PSA | 34.14000 |
| LogP | 4.00750 |
| Vapour Pressure | 3.08E-08mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | HJTUINCBGMVXOB-LNMJFAINSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2=CCC2(C)C(=O)CCC12 |
| Hazard Codes | Xn |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]-androstenedion...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3804707
|
|
Name: Inhibition of human placental aromatase expressed in human MCF7 cells using [1beta-3H...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3804712
|
| 9-Dehydroandrostenedione |
| UNII-9329RS039I |