2,3,5,6-Tetrachloropyridine-4-thiol structure
|
Common Name | 2,3,5,6-Tetrachloropyridine-4-thiol | ||
|---|---|---|---|---|
| CAS Number | 10351-06-1 | Molecular Weight | 248.94500 | |
| Density | 1.79 g/cm3 | Boiling Point | 204.6ºC at 760 mmHg | |
| Molecular Formula | C5HCl4NS | Melting Point | 165-166 °C(lit.) | |
| MSDS | N/A | Flash Point | 77.5ºC | |
| Name | 2,3,5,6-tetrachloro-1H-pyridine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79 g/cm3 |
|---|---|
| Boiling Point | 204.6ºC at 760 mmHg |
| Melting Point | 165-166 °C(lit.) |
| Molecular Formula | C5HCl4NS |
| Molecular Weight | 248.94500 |
| Flash Point | 77.5ºC |
| Exact Mass | 246.85800 |
| PSA | 51.69000 |
| LogP | 3.98390 |
| Vapour Pressure | 0.262mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | LVUQDNJRAHUUSB-UHFFFAOYSA-N |
| SMILES | S=c1c(Cl)c(Cl)[nH]c(Cl)c1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~67%
2,3,5,6-Tetrach... CAS#:10351-06-1 |
| Literature: Sipyagin, A. M.; Pal'tsun, S. V.; Pomytkin, I. A.; Aleinikov, N. N. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1994 , vol. 30, # 1 p. 56 - 59 Khimiya Geterotsiklicheskikh Soedinenii, 1994 , # 1 p. 63 - 67 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,5,6-Tetrachlor-4-pyridylmercaptan |
| EINECS 233-764-0 |
| 2,3,5,6-Tetrachlor-4-mercapto-pyridin |
| MFCD00006231 |
| 2,3,5,6-Tetrachloro-4-pyridinethiol |
| 2,3,4,5,6-PENTAKISTRIFLUOROMETHYLPHENOL |
| 4-Pyridinethiol,2,3,5,6-tetrachloro |
| Tetrachloropyridine-4-thiol |
| 2,3,5,6-tetrachloro-4-mercaptopyridine |
| 2,3,5,6-tetrachloro-pyridine-4-thiol |
| 2,3,5,6-Tetrachlorpyridin-4-thiol |