[(4-chlorophenyl)sulfanyl-(4-methylphenyl)methyl]-trimethylsilane structure
|
Common Name | [(4-chlorophenyl)sulfanyl-(4-methylphenyl)methyl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 103559-10-0 | Molecular Weight | 320.95200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21ClSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(4-chlorophenyl)sulfanyl-(4-methylphenyl)methyl]-trimethylsilane |
|---|
| Molecular Formula | C17H21ClSSi |
|---|---|
| Molecular Weight | 320.95200 |
| Exact Mass | 320.08200 |
| PSA | 25.30000 |
| LogP | 6.45470 |
| InChIKey | OHUBGRAZSYRIRZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(Sc2ccc(Cl)cc2)[Si](C)(C)C)cc1 |
|
~92%
[(4-chloropheny... CAS#:103559-10-0 |
| Literature: Ishibashi, Hiroyuki; Nakatani, Hiroshi; Umei, Yoshizumi; Yamamoto, Wako; Ikeda, Masazumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 589 - 594 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |