[chloro-(4-chlorophenyl)sulfanylmethyl]-trimethylsilane structure
|
Common Name | [chloro-(4-chlorophenyl)sulfanylmethyl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 103559-17-7 | Molecular Weight | 265.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14Cl2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [chloro-(4-chlorophenyl)sulfanylmethyl]-trimethylsilane |
|---|
| Molecular Formula | C10H14Cl2SSi |
|---|---|
| Molecular Weight | 265.27500 |
| Exact Mass | 263.99600 |
| PSA | 25.30000 |
| LogP | 5.29430 |
| InChIKey | IITXVAHTAPLNGJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(Cl)Sc1ccc(Cl)cc1 |
|
~90%
[chloro-(4-chlo... CAS#:103559-17-7 |
| Literature: Ishibashi, Hiroyuki; Nakatani, Hiroshi; Umei, Yoshizumi; Yamamoto, Wako; Ikeda, Masazumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 589 - 594 |
|
~%
[chloro-(4-chlo... CAS#:103559-17-7 |
| Literature: Ishibashi, Hiroyuki; Nakatani, Hiroshi; Umei, Yoshizumi; Yamamoto, Wako; Ikeda, Masazumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 589 - 594 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |