estradiol 17-dihydrotrigonelline structure
|
Common Name | estradiol 17-dihydrotrigonelline | ||
|---|---|---|---|---|
| CAS Number | 103562-82-9 | Molecular Weight | 393.51900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of estradiol 17-dihydrotrigonellineE2-CDS (Estradiol 17-Dihydrotrigonelline) is a redox-based chemical delivery system for estradiol (E2). E2-CDS is capable of sustained and brain-selective delivery of estradiol[1]. |
| Name | estredox |
|---|---|
| Synonym | More Synonyms |
| Description | E2-CDS (Estradiol 17-Dihydrotrigonelline) is a redox-based chemical delivery system for estradiol (E2). E2-CDS is capable of sustained and brain-selective delivery of estradiol[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H31NO3 |
|---|---|
| Molecular Weight | 393.51900 |
| Exact Mass | 393.23000 |
| PSA | 49.77000 |
| LogP | 4.83110 |
| InChIKey | KTMLJZFJHDUEAU-ZZDGKJOTSA-N |
| SMILES | CN1C=CCC(C(=O)OC2CCC3C4CCc5cc(O)ccc5C4CCC23C)=C1 |
| 3-hydroxy-17β-<<(1-methyl-1,4-dihydropyridin-3-yl)carbonyl>oxy>estra-1,3,5(10)-triene |
| 17β-[(1-methyl-1,4-dihydro-3-pyridinyl)carbonyloxy]estra-1,3,5(10)-trien-3-ol |
| estra-1,3,5(10)-triene-3,17β-diol-17-(1,4-dihydro-1-methylpyridine-3-carboxylate) |
| 3-hydroxy-17β-{[(1-methyl-1,4-dihydropyridin-3-yl)carbonyl]oxy}estra-1,3,5(10)-triene |
| 3-hydroxy-17β-<<(1-methyl-1,4-dihydropyridin-3-yl)-carbonyl>-oxy>estra-1,3,5(10)-triene |
| 17β-[(1-Methyl-1,4-dihydro-3-pyridinyl)carbonyloxy]estra-1,3,5(10)-trien-3-ol |
| 1-Methyl-1,4-dihydro-pyridine-3-carboxylic acid (8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-17-yl ester |