Bisoctrizole structure
|
Common Name | Bisoctrizole | ||
|---|---|---|---|---|
| CAS Number | 103597-45-1 | Molecular Weight | 658.875 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 771.6±70.0 °C at 760 mmHg | |
| Molecular Formula | C41H50N6O2 | Melting Point | 197-199 °C(lit.) | |
| MSDS | USA | Flash Point | 420.5±35.7 °C | |
Use of BisoctrizoleBisoctrizole is a broad-spectrum ultraviolet radiation absorber, absorbing UVB as well as UVA rays; also reflects and scatters UV. |
| Name | Ultraviolet Absorbent UV-360 |
|---|---|
| Synonym | More Synonyms |
| Description | Bisoctrizole is a broad-spectrum ultraviolet radiation absorber, absorbing UVB as well as UVA rays; also reflects and scatters UV. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 771.6±70.0 °C at 760 mmHg |
| Melting Point | 197-199 °C(lit.) |
| Molecular Formula | C41H50N6O2 |
| Molecular Weight | 658.875 |
| Flash Point | 420.5±35.7 °C |
| Exact Mass | 658.399536 |
| PSA | 101.88000 |
| LogP | 14.35 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | FQUNFJULCYSSOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)c1cc(Cc2cc(C(C)(C)CC(C)(C)C)cc(-n3nc4ccccc4n3)c2O)c(O)c(-n2nc3ccccc3n2)c1 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| Phenol, 2,2'-methylenebis[6-(2H-1,2,3-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)- |
| Tinosorb M |
| MBBT |
| 2,2'-Methylenebis[6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol] |
| 2,2-Methylenebis[6-(Benzotriazol-2-yl)-4-Tert-Octylphenol] |
| 2,2'-Methylenebis[6-(2H-benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol] |
| Bisoctrizole |
| 2,2’-Methylenebis[6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol] |
| T56 BNNNJ CR BQ EX1&1&1X1&1&1 C1R BQ EX1&1&1X1&1&1 C- BT56 BNNNJ |
| 2-(benzotriazol-2-yl)-6-[[3-(benzotriazol-2-yl)-2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
| Bis[3-(benzotriazol-2-yl)-2-hydroxy-5-tert-octylphenyl]methane |
| 2,2'-Methanediylbis[6-(2H-benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol] |
| 2,2'-Methylenebis[6-(2H-benzotriazol-2-yl)-4-(2,4,4-trimethyl-2-pentanyl)phenol] |
| EINECS 403-800-1 |
| MFCD00192289 |
| 2,2'-Methylenebis[6-(benzotriazol-2-yl)-4-tert-octylphenol] |
| methylene bis-benzotriazolyl tetramethylbutylphenol. |