3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl(allyl) ether structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl(allyl) ether | ||
|---|---|---|---|---|
| CAS Number | 103628-86-0 | Molecular Weight | 404.16800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F13O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-prop-2-enoxyoctane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9F13O |
|---|---|
| Molecular Weight | 404.16800 |
| Exact Mass | 404.04500 |
| PSA | 9.23000 |
| LogP | 5.31790 |
| InChIKey | GPVGUNIIVWJTLK-UHFFFAOYSA-N |
| SMILES | C=CCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~95%
3,3,4,4,5,5,6,6... CAS#:103628-86-0 |
| Literature: Boutevin, B.; Youssef, B.; Boileau, S.; Garnault, A. M. Journal of Fluorine Chemistry, 1987 , vol. 35, p. 399 - 410 |
|
~84%
3,3,4,4,5,5,6,6... CAS#:103628-86-0 |
| Literature: Smith; Brisdon; Brewer; Willis Journal of Materials Chemistry, 2000 , vol. 10, # 8 p. 1765 - 1769 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| propenyloxy-1H,1H,2H,2H-perfluorooctane |
| Allyl 1H,1H,2H,2H-perfluorooctyl ether |
| PC4961 |