3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanol structure
|
Common Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanol | ||
|---|---|---|---|---|
| CAS Number | 647-42-7 | Molecular Weight | 364.104 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 174.1±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F13O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 91.7±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 174.1±0.0 °C at 760 mmHg |
| Molecular Formula | C8H5F13O |
| Molecular Weight | 364.104 |
| Flash Point | 91.7±0.0 °C |
| Exact Mass | 364.013275 |
| PSA | 20.23000 |
| LogP | 4.16 |
| Vapour Pressure | 0.4±0.7 mmHg at 25°C |
| Index of Refraction | 1.298 |
| InChIKey | GRJRKPMIRMSBNK-UHFFFAOYSA-N |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 1 |
| HS Code | 2905590090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Single-cell screening of photosynthetic growth and lactate production by cyanobacteria.
Biotechnol. Biofuels 8 , 193, (2015) Photosynthetic cyanobacteria are attractive for a range of biotechnological applications including biofuel production. However, due to slow growth, screening of mutant libraries using microtiter plate... |
|
|
Sustained release of hydrophobic drugs by the microfluidic assembly of multistage microgel/poly (lactic-co-glycolic acid) nanoparticle composites.
Biomicrofluidics 9 , 052601, (2015) The poor solubility of many newly discovered drugs has resulted in numerous challenges for the time-controlled release of therapeutics. In this study, an advanced drug delivery platform to encapsulate... |
| 1-Octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
| MFCD00042143 |
| 1H,1H,2H,2H-Perfluorooctan-1-ol |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanol |
| EINECS 211-477-1 |
| 1H,1H,2H,2H-Perfluorooctanol |
| 1H, 1H, 2H, 2H-Perfluorooctan-1-ol |