Methyl 3-nitroisonicotinate structure
|
Common Name | Methyl 3-nitroisonicotinate | ||
|---|---|---|---|---|
| CAS Number | 103698-10-8 | Molecular Weight | 182.133 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 278.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.3±21.8 °C | |
| Name | Methyl 3-nitroisonicotinate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.6±20.0 °C at 760 mmHg |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.133 |
| Flash Point | 122.3±21.8 °C |
| Exact Mass | 182.032761 |
| PSA | 85.01000 |
| LogP | 0.45 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | VFZBLITUPLITGH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccncc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~72%
Methyl 3-nitroi... CAS#:103698-10-8 |
| Literature: Stockmann, Vegar; Fiksdahl, Anne Journal of Heterocyclic Chemistry, 2011 , vol. 48, # 6 p. 1383 - 1387 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 3-nitropyridine-4-carboxylate |
| 4-Pyridinecarboxylic acid, 3-nitro-, methyl ester |
| Methyl 3-nitroisonicotinate |