1,1,1,2,3,3,3-heptafluoro-2-(1,2,2-trifluoroethenoxy)propane structure
|
Common Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,2,2-trifluoroethenoxy)propane | ||
|---|---|---|---|---|
| CAS Number | 10372-98-2 | Molecular Weight | 266.03700 | |
| Density | 1.609g/cm3 | Boiling Point | 62.4ºC at 760mmHg | |
| Molecular Formula | C5F10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 62.4ºC at 760mmHg |
| Molecular Formula | C5F10O |
| Molecular Weight | 266.03700 |
| Exact Mass | 265.97900 |
| PSA | 9.23000 |
| LogP | 3.82850 |
| Vapour Pressure | 191mmHg at 25°C |
| Index of Refraction | 1.272 |
| InChIKey | BJURIXFNPBYZNB-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)OC(F)(C(F)(F)F)C(F)(F)F |
| HS Code | 2909199090 |
|---|
|
~%
1,1,1,2,3,3,3-h... CAS#:10372-98-2 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.1, 1.2, page 1 - 15 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| einecs 233-813-6 |