1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane
1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane structure
|
Common Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane | ||
|---|---|---|---|---|
| CAS Number | 16005-38-2 | Molecular Weight | 411.94000 | |
| Density | 2.097g/cm3 | Boiling Point | 88ºC | |
| Molecular Formula | C5F11IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 26.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.097g/cm3 |
|---|---|
| Boiling Point | 88ºC |
| Molecular Formula | C5F11IO |
| Molecular Weight | 411.94000 |
| Flash Point | 26.7ºC |
| Exact Mass | 411.88200 |
| PSA | 9.23000 |
| LogP | 4.41400 |
| Vapour Pressure | 18.2mmHg at 25°C |
| Index of Refraction | 1.343 |
| InChIKey | ZTRORDXSFFFPOW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(F)I)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2909199090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1,1,2,3,3,3-h... CAS#:16005-38-2 |
| Literature: Evans,F.W. et al. Journal of Organic Chemistry, 1968 , vol. 33, # 5 p. 1839 - 1844 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:104745-21-3
CAS#:104745-22-4
CAS#:10372-98-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-iodo-4-trifluoromethyl-3-oxaperfluoropentane |
| 4-trifluoromethyl-3-oxa-perfluoropentyliodide |
| Perfluorpropyl-2-iodtetrafluorethylether |
| Heptafluorisopropyl-2-iodtetrafluorethylether |
| Perfluorisopropyl-2'-jod-tetrafluoraethyl-aether |
| PC0308 |
| perfluoro-1-iodo-3-oxa-4-trifluoromethylpentane |
| 2-Iodotetrafluoroethyl heptafluoroisopropyl ether |
| 1,1,2,2-Tetrafluoro-1-iodo-2-heptafluoroisopropoxyethane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane have? |
| A: English synonyms of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane: 1-iodo-4-trifluoromethyl-3-oxaperfluoropentane, 4-trifluoromethyl-3-oxa-perfluoropentyliodide, Perfluorpropyl-2-iodtetrafluorethylether, Heptafluorisopropyl-2-iodtetrafluorethylether, Perfluorisopropyl-2'-jod-tetrafluoraethyl-aether, PC0308, perfluoro-1-iodo-3-oxa-4-trifluoromethylpentane, 2-Iodotetrafluoroethyl heptafluoroisopropyl ether, 1,1,2,2-Tetrafluoro-1-iodo-2-heptafluoroisopropoxyethane. |
| Q: What is the boiling point of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: Boiling point of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is 88ºC. |
| Q: What is the molecular formula of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: Molecular formula of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is C5F11IO. |
| Q: What is the InChIKey of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: InChIKey of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is ZTRORDXSFFFPOW-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: Related upstream materials(CAS) of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane: 116-14-3;684-16-2. |
| Q: What is the LogP of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: LogP of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is 4.41400. |
| Q: What is the CAS number of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: CAS number of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is 16005-38-2. |
| Q: What is the polar surface area (PSA) of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: Polar surface area (PSA) of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is 9.23000. |
| Q: What is the safety information for 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: Safety information for 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane: S26. |
| Q: What is the molecular weight of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane? |
| A: Molecular weight of 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane is 411.94000. |