Moexipril Diketopiperazine structure
|
Common Name | Moexipril Diketopiperazine | ||
|---|---|---|---|---|
| CAS Number | 103733-51-3 | Molecular Weight | 480.55300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (2S)-2-[(3S,11aS)-8,9-dimethoxy-3-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H32N2O6 |
|---|---|
| Molecular Weight | 480.55300 |
| Exact Mass | 480.22600 |
| PSA | 85.38000 |
| LogP | 2.62810 |
| InChIKey | UYPPDNXTLSUNRF-HSQYWUDLSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)N1C(=O)C2Cc3cc(OC)c(OC)cc3CN2C(=O)C1C |
| RIDADR | NONH for all modes of transport |
|---|
|
~82%
Moexipril Diket... CAS#:103733-51-3 |
| Literature: Klutchko; Blankley; Fleming; Hinkley; Werner; Nordin; Holmes; Hoefle; Cohen; Essenburg Journal of Medicinal Chemistry, 1986 , vol. 29, # 10 p. 1953 - 1961 |
|
~%
Moexipril Diket... CAS#:103733-51-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 10 p. 1953 - 1961 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| UNII-6SJ97G618S |
| Moexipril Diketopiperazine |
| Moexipril related compound B |