Trandolapril Diketopiperazine structure
|
Common Name | Trandolapril Diketopiperazine | ||
|---|---|---|---|---|
| CAS Number | 149881-40-3 | Molecular Weight | 412.522 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 607.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.2±31.5 °C | |
| Name | RU-46178 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 607.5±55.0 °C at 760 mmHg |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.522 |
| Flash Point | 321.2±31.5 °C |
| Exact Mass | 412.236206 |
| LogP | 4.03 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | AKUCMKAPHCGRFV-WTNASJBWSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)N1C(=O)C2CC3CCCCC3N2C(=O)C1C |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|
| RU-46178 |
| Pyrazino[1,2-a]indole-2(1H)-acetic acid, decahydro-3-methyl-1,4-dioxo-α-(2-phenylethyl)-, ethyl ester, (αS,3S,5aS,9aR,10aS)- |
| 4768A319U6 |
| Ethyl (2S)-2-[(3S,5aS,9aR,10aS)-3-methyl-1,4-dioxodecahydropyrazino[1,2-a]indol-2(1H)-yl]-4-phenylbutanoate |