4,5-Diethoxy-2-nitrobenzoic acid structure
|
Common Name | 4,5-Diethoxy-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 103796-34-5 | Molecular Weight | 255.22400 | |
| Density | 1.31 | Boiling Point | 424.826ºC at 760 mmHg | |
| Molecular Formula | C11H13NO6 | Melting Point | 142-145ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-Diethoxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31 |
|---|---|
| Boiling Point | 424.826ºC at 760 mmHg |
| Melting Point | 142-145ºC |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.22400 |
| Exact Mass | 255.07400 |
| PSA | 101.58000 |
| LogP | 2.61360 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | FULLWXSFKCFUCD-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C(=O)O)c([N+](=O)[O-])cc1OCC |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4,5-diethoxy-2-nitro |
| 4,5-diethoxy-2-nitro-benzoic Acid |
| 4,5-Diaethoxy-2-nitro-benzoesaeure |
| Diaethylaether-6-nitro-protocatechusaeure |
| 2-nitro-4,5-diethoxybenzoic acid |