4,5-Dimethoxy-2-nitrobenzoic acid structure
|
Common Name | 4,5-Dimethoxy-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 4998-07-6 | Molecular Weight | 227.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 409.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO6 | Melting Point | 195-197 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 201.4±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,5-Dimethoxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.5±45.0 °C at 760 mmHg |
| Melting Point | 195-197 °C(lit.) |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.171 |
| Flash Point | 201.4±28.7 °C |
| Exact Mass | 227.042984 |
| PSA | 101.58000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | WWCMFGBGMJAJRX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c([N+](=O)[O-])cc1OC |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
4-(3'-Bromo-4'hydroxylphenyl)-amino-6,7-dimethoxyquinazoline: a novel quinazoline derivative with potent cytotoxic activity against human glioblastoma cells.
Clin. Cancer Res. 4(6) , 1405-14, (1998) The novel quinazoline derivative 4-(3'-bromo-4'-hydroxylphenyl)-amino-6,7-dimethoxyquinazoline (WHI-P154) exhibited significant cytotoxicity against U373 and U87 human glioblastoma cell lines, causing... |
|
|
Role of tyrosine kinases in induction of the c-jun proto-oncogene in irradiated B-lineage lymphoid cells.
J. Biol. Chem. 273(28) , 17742-8, (1998) Exposure of B-lineage lymphoid cells to ionizing radiation induces an elevation of c-jun proto-oncogene mRNA levels. This signal is abrogated by protein-tyrosine kinase (PTK) inhibitors, indicating th... |
|
|
Degradation of 5-nitroguaiacol by soil bacteria of the genus Rhodococcus.
Folia Microbiol. (Praha) 49(5) , 613-5, (2004) Two bacterial strains were isolated from forest soil by selective enrichment of the mineral medium containing 4-nitropyrocatechol as the sole carbon and energy source. Both strains could utilize 4-nit... |
| 3,4-DIMETHOXY-6-NITROBENZOIC ACID |
| 4,5-Dimethoxy-2-nitr |
| 4,5-Dimethoxy-2-nitrobenzoic |
| 6-NITROVERATRIC ACID |
| EINECS 225-657-2 |
| 4,5-Dimethoxy-2-nitrobenzoic acid |
| Benzoic acid, 4,5-dimethoxy-2-nitro- |
| 2-nitroveratric acid |
| RARECHEM AL BO 1523 |
| MFCD00014697 |
| 4,5-dimethoxy-2-nitro-benzoic acid |
| 6-Nitroveratriceacid |
| 2-NITRO-4,5-DIMETHOXYBENZOIC ACID |