2,2',3,3',5,5',6,6'-octafluorobenzidine structure
|
Common Name | 2,2',3,3',5,5',6,6'-octafluorobenzidine | ||
|---|---|---|---|---|
| CAS Number | 1038-66-0 | Molecular Weight | 328.161 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 279.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H4F8N2 | Melting Point | 175-177 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 124.7±16.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-amino-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluoroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.4±35.0 °C at 760 mmHg |
| Melting Point | 175-177 °C(lit.) |
| Molecular Formula | C12H4F8N2 |
| Molecular Weight | 328.161 |
| Flash Point | 124.7±16.6 °C |
| Exact Mass | 328.024689 |
| PSA | 52.04000 |
| LogP | 6.47 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | FWOLORXQTIGHFX-UHFFFAOYSA-N |
| SMILES | Nc1c(F)c(F)c(-c2c(F)c(F)c(N)c(F)c2F)c(F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,T |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | UN 3152 9/PG 2 |
| WGK Germany | 3 |
|
~82%
2,2',3,3',5,5',... CAS#:1038-66-0 |
| Literature: Russian Chemical Bulletin, , vol. 56, # 11 p. 2239 - 2246 |
|
~%
2,2',3,3',5,5',... CAS#:1038-66-0 |
| Literature: Journal of the Chemical Society, , p. 1864 - 1869 |
|
~%
2,2',3,3',5,5',... CAS#:1038-66-0 |
| Literature: Journal of the Chemical Society, , p. 1864 - 1869 |
|
~%
2,2',3,3',5,5',... CAS#:1038-66-0 |
| Literature: Journal of the Chemical Society, , p. 1864 - 1869 |
| 2,2',3,3',5,5',6,6'-octafluoro-biphenyl-4,4'-diamine |
| 4,4'-diaminooctafluoro biphenyl |
| octafluoro-4,4'-biphenylenediamine |
| 4,4'-Diaminoctafluorobiphenyl |
| 4,4'-diamino-2,2',3,3',5,5',6,6'-octafluorobiphenyl |
| 4,4'-Diaminooctafluorodiphenyl |
| EINECS 213-861-4 |
| Benzidine, 2,2',3,3',5,5',6,6'-octafluoro- |
| 4,4'-Biphenyldiamine, 2,2',3,3',5,5',6,6'-octafluoro- |
| 2,2',3,3',5,5',6,6'-Octafluorobiphenyl-4,4'-diamine |
| MFCD00007646 |
| [1,1'-Biphenyl]-4,4'-diamine, 2,2',3,3',5,5',6,6'-octafluoro- |
| Octafluorobenzidine |
| 2,2',3,3',5,5',6,6'-Octafluoro-4,4'-biphenyldiamine |
| 2,2',3,3',5,5',6,6'-octafluorobenzidine |
| 4,4'-DiaMinooctafluorobiphenyl |
| Benzidine,2,2',3,3',5,5',6,6'-octafluoro |
| (1,1'-Biphenyl)-4,4'-diamine, 2,2',3,3',5,5',6,6'-octafluoro- |
| 4,4’-Diaminooctafluorobiphenyl |