(3β,9β)-9,19-Cyclolanost-25-ene-3,24-diol structure
|
Common Name | (3β,9β)-9,19-Cyclolanost-25-ene-3,24-diol | ||
|---|---|---|---|---|
| CAS Number | 10388-48-4 | Molecular Weight | 442.717 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 537.7±23.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9±17.2 °C | |
Use of (3β,9β)-9,19-Cyclolanost-25-ene-3,24-diolCycloart-25-ene-3β,24-diol is a natural triterpene[1]. |
| Name | (2aR,3R,5aS,5bS,7aR,9S,11aR,12aS)-3-((2R)-5-hydroxy-6-methylhept-6-en-2-yl)-2a,5a,8,8-tetramethyltetradecahydro-1H,12H-cyclopenta[a]cyclopropa[e]phenanthren-9-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Cycloart-25-ene-3β,24-diol is a natural triterpene[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.7±23.0 °C at 760 mmHg |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.717 |
| Flash Point | 218.9±17.2 °C |
| Exact Mass | 442.381073 |
| PSA | 40.46000 |
| LogP | 8.88 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | MHGLNDDJLDJDBG-GQRMPXKBSA-N |
| SMILES | C=C(C)C(O)CCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC45CC35CCC12C |
| Hazard Codes | Xi |
|---|
| 9,19-Cyclolanost-25-ene-3,24-diol, (3β,9β)- |
| (3β,9β)-9,19-Cyclolanost-25-ene-3,24-diol |