6-FLUORO-2-PHENYL-4-QUINOLINOL structure
|
Common Name | 6-FLUORO-2-PHENYL-4-QUINOLINOL | ||
|---|---|---|---|---|
| CAS Number | 103914-44-9 | Molecular Weight | 239.24400 | |
| Density | 1.269g/cm3 | Boiling Point | 389.294ºC at 760 mmHg | |
| Molecular Formula | C15H10FNO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 189.238ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 6-fluoro-2-phenyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 389.294ºC at 760 mmHg |
| Molecular Formula | C15H10FNO |
| Molecular Weight | 239.24400 |
| Flash Point | 189.238ºC |
| Exact Mass | 239.07500 |
| PSA | 33.12000 |
| LogP | 3.74650 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | YKZPWHOKZPODTO-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)[nH]c2ccc(F)cc12 |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| 6-Fluoro-2-phenyl-4-quinolinol |