15-r-14-oxolabda-8(17),12-dien-18-oic acid structure
|
Common Name | 15-r-14-oxolabda-8(17),12-dien-18-oic acid | ||
|---|---|---|---|---|
| CAS Number | 1039673-32-9 | Molecular Weight | 304.42 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 442.4±38.0 °C at 760 mmHg | |
| Molecular Formula | C19H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5±23.3 °C | |
Use of 15-r-14-oxolabda-8(17),12-dien-18-oic acid15-Nor-14-oxolabda-8(17),12E-Diene-18-oic acid (compound 9) is a compound isolated from the roots of Chloranthus spicatus[1]. |
| Name | (1R,4aR,5S,8aR)-1,4a-Dimethyl-6-methylene-5-[(2E)-3-methyl-4-oxo- 2-buten-1-yl]decahydro-1-naphthalenecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 15-Nor-14-oxolabda-8(17),12E-Diene-18-oic acid (compound 9) is a compound isolated from the roots of Chloranthus spicatus[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Zhi-Yong Xiao, et al. Terpenoids from Roots of Chloranthus spicatus. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.4±38.0 °C at 760 mmHg |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.42 |
| Flash Point | 235.5±23.3 °C |
| Exact Mass | 304.203857 |
| PSA | 54.37000 |
| LogP | 4.84 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | NBGCWDAYASHSEK-UKBAYJJMSA-N |
| SMILES | C=C1CCC2C(C)(C(=O)O)CCCC2(C)C1CC=C(C)C=O |
| Hazard Codes | Xi |
|---|
| (1S,4aS,5S,8aR)-1,4a-Dimethyl-6-methylene-5-[(2E)-3-methyl-4-oxo-2-buten-1-yl]decahydro-1-naphthalenecarboxylic acid |
| 1-Naphthalenecarboxylic acid, decahydro-1,4a-dimethyl-6-methylene-5-[(2E)-3-methyl-4-oxo-2-buten-1-yl]-, (1R,4aR,5S,8aR)- |
| dimyristyl ketone |
| Di-n-tetradecyl-keton |
| Ditetradecylketon |
| Nonacosan-15-on |
| 15-Nonacosanone |
| (1R,4aR,5S,8aR)-1,4a-Dimethyl-6-methylene-5-[(2E)-3-methyl-4-oxo-2-buten-1-yl]decahydro-1-naphthalenecarboxylic acid |
| 1-Naphthalenecarboxylic acid, decahydro-1,4a-dimethyl-6-methylene-5-[(2E)-3-methyl-4-oxo-2-buten-1-yl]-, (1S,4aS,5S,8aR)- |